C11H12FNO2 — CID 71278100
N-(4-fluorophenyl)-3-methyloxetane-3-carboxamide (PubChem CID 71278100) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-methyloxetane-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-methyloxetane-3-carboxamide |
|---|---|
| PubChem CID | 71278100 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-(4-fluorophenyl)-3-methyloxetane-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(F)cc2)COC1 |
| InChI | InChI=1S/C11H12FNO2/c1-11(6-15-7-11)10(14)13-9-4-2-8(12)3-5-9/h2-5H,6-7H2,1H3,(H,13,14) |
| InChIKey | VPMBLHAWTNTIES-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |