C15H15ClN4O4S — CID 146022428
N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-3-methyloxetane-3-carboxamide (PubChem CID 146022428) has the molecular formula C15H15ClN4O4S and a molecular weight of 382.83 g/mol. Its IUPAC name is N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-3-methyloxetane-3-carboxamide.
| Compound Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-3-methyloxetane-3-carboxamide |
|---|---|
| PubChem CID | 146022428 |
| Molecular Formula | C15H15ClN4O4S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-3-methyloxetane-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)nn3)cc2)COC1 |
| InChI | InChI=1S/C15H15ClN4O4S/c1-15(8-24-9-15)14(21)17-10-2-4-11(5-3-10)25(22,23)20-13-7-6-12(16)18-19-13/h2-7H,8-9H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | YMGOMMRLCVDFMS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |