C18H17ClN6O3S2 — CID 25049208
N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-2-pyrimidin-2-ylsulfanylbutanamide (PubChem CID 25049208) has the molecular formula C18H17ClN6O3S2 and a molecular weight of 464.96 g/mol. Its IUPAC name is N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-2-pyrimidin-2-ylsulfanylbutanamide.
| Compound Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-2-pyrimidin-2-ylsulfanylbutanamide |
|---|---|
| PubChem CID | 25049208 |
| Molecular Formula | C18H17ClN6O3S2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-2-pyrimidin-2-ylsulfanylbutanamide |
| SMILES | CCC(Sc1ncccn1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C18H17ClN6O3S2/c1-2-14(29-18-20-10-3-11-21-18)17(26)22-12-4-6-13(7-5-12)30(27,28)25-16-9-8-15(19)23-24-16/h3-11,14H,2H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | AOORHRQCXKUVDL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |