C16H14Cl2N6O3S — CID 19477223
4-chloro-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-ethylpyrazole-5-carboxamide (PubChem CID 19477223) has the molecular formula C16H14Cl2N6O3S and a molecular weight of 441.30 g/mol. Its IUPAC name is 4-chloro-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19477223 |
| Molecular Formula | C16H14Cl2N6O3S |
| Molecular Weight | 441.30 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 4-chloro-N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(Cl)c1C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C16H14Cl2N6O3S/c1-2-24-15(12(17)9-19-24)16(25)20-10-3-5-11(6-4-10)28(26,27)23-14-8-7-13(18)21-22-14/h3-9H,2H2,1H3,(H,20,25)(H,22,23) |
| InChIKey | QDGGKLQZACXBOY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |