C15H12ClN7O5S — CID 19263895
N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 19263895) has the molecular formula C15H12ClN7O5S and a molecular weight of 437.83 g/mol. Its IUPAC name is N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19263895 |
| Molecular Formula | C15H12ClN7O5S |
| Molecular Weight | 437.83 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | N-[4-[(6-chloropyridazin-3-yl)sulfamoyl]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)nn3)cc2)n1 |
| InChI | InChI=1S/C15H12ClN7O5S/c1-22-8-11(23(25)26)14(20-22)15(24)17-9-2-4-10(5-3-9)29(27,28)21-13-7-6-12(16)18-19-13/h2-8H,1H3,(H,17,24)(H,19,21) |
| InChIKey | JNTUATYKCKFEFS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 162.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.83 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|