C16H19ClN4O4S — CID 19477261
4-chloro-1-ethyl-N-(4-morpholin-4-ylsulfonylphenyl)pyrazole-5-carboxamide (PubChem CID 19477261) has the molecular formula C16H19ClN4O4S and a molecular weight of 398.87 g/mol. Its IUPAC name is 4-chloro-1-ethyl-N-(4-morpholin-4-ylsulfonylphenyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-1-ethyl-N-(4-morpholin-4-ylsulfonylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19477261 |
| Molecular Formula | C16H19ClN4O4S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4-chloro-1-ethyl-N-(4-morpholin-4-ylsulfonylphenyl)pyrazole-5-carboxamide |
| SMILES | CCn1ncc(Cl)c1C(=O)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H19ClN4O4S/c1-2-21-15(14(17)11-18-21)16(22)19-12-3-5-13(6-4-12)26(23,24)20-7-9-25-10-8-20/h3-6,11H,2,7-10H2,1H3,(H,19,22) |
| InChIKey | VFNURUGBBZOIDZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |