C27H27N5O2 — CID 167233495
(4Z,6E)-6-(imidazol-1-ylmethyl)-N-(7-methoxy-4-phenyl-1H-benzimidazol-2-yl)-2-methylideneocta-4,6-dienamide (PubChem CID 167233495) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is (4Z,6E)-6-(imidazol-1-ylmethyl)-N-(7-methoxy-4-phenyl-1H-benzimidazol-2-yl)-2-methylideneocta-4,6-dienamide.
| Compound Name | (4Z,6E)-6-(imidazol-1-ylmethyl)-N-(7-methoxy-4-phenyl-1H-benzimidazol-2-yl)-2-methylideneocta-4,6-dienamide |
|---|---|
| PubChem CID | 167233495 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (4Z,6E)-6-(imidazol-1-ylmethyl)-N-(7-methoxy-4-phenyl-1H-benzimidazol-2-yl)-2-methylideneocta-4,6-dienamide |
| SMILES | C=C(C/C=C\C(=C/C)Cn1ccnc1)C(=O)Nc1nc2c(-c3ccccc3)ccc(OC)c2[nH]1 |
| InChI | InChI=1S/C27H27N5O2/c1-4-20(17-32-16-15-28-18-32)10-8-9-19(2)26(33)31-27-29-24-22(21-11-6-5-7-12-21)13-14-23(34-3)25(24)30-27/h4-8,10-16,18H,2,9,17H2,1,3H3,(H2,29,30,31,33)/b10-8-,20-4+ |
| InChIKey | SEKXOSOCBLMNPE-PPHGQABJSA-N |
| XLogP | 5.52 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|