C16H12N2O4S — CID 22283377
2-[(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)amino]-2-oxoacetic acid (PubChem CID 22283377) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-[(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)amino]-2-oxoacetic acid.
| Compound Name | 2-[(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 22283377 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)amino]-2-oxoacetic acid |
| SMILES | COc1ccc(-c2ccccc2)c2sc(NC(=O)C(=O)O)nc12 |
| InChI | InChI=1S/C16H12N2O4S/c1-22-11-8-7-10(9-5-3-2-4-6-9)13-12(11)17-16(23-13)18-14(19)15(20)21/h2-8H,1H3,(H,20,21)(H,17,18,19) |
| InChIKey | IMDVLPRBTUBBND-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|