C25H26ClN3O2S — CID 22283213
N-(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)-4-(propylaminomethyl)benzamide;hydrochloride (PubChem CID 22283213) has the molecular formula C25H26ClN3O2S and a molecular weight of 468.02 g/mol. Its IUPAC name is N-(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)-4-(propylaminomethyl)benzamide;hydrochloride.
| Compound Name | N-(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)-4-(propylaminomethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 22283213 |
| Molecular Formula | C25H26ClN3O2S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-(4-methoxy-7-phenyl-1,3-benzothiazol-2-yl)-4-(propylaminomethyl)benzamide;hydrochloride |
| SMILES | CCCNCc1ccc(C(=O)Nc2nc3c(OC)ccc(-c4ccccc4)c3s2)cc1.Cl |
| InChI | InChI=1S/C25H25N3O2S.ClH/c1-3-15-26-16-17-9-11-19(12-10-17)24(29)28-25-27-22-21(30-2)14-13-20(23(22)31-25)18-7-5-4-6-8-18;/h4-14,26H,3,15-16H2,1-2H3,(H,27,28,29);1H |
| InChIKey | DHMWNSMOPIVPDN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|