C31H35F2N7O2 — CID 167241099
4-[6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-9-methylpurin-8-yl]-6-fluoro-5-methylnaphthalen-2-ol (PubChem CID 167241099) has the molecular formula C31H35F2N7O2 and a molecular weight of 575.66 g/mol. Its IUPAC name is 4-[6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-9-methylpurin-8-yl]-6-fluoro-5-methylnaphthalen-2-ol.
| Compound Name | 4-[6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-9-methylpurin-8-yl]-6-fluoro-5-methylnaphthalen-2-ol |
|---|---|
| PubChem CID | 167241099 |
| Molecular Formula | C31H35F2N7O2 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 4-[6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[[(8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-9-methylpurin-8-yl]-6-fluoro-5-methylnaphthalen-2-ol |
| SMILES | Cc1c(F)ccc2cc(O)cc(-c3nc4c(N5CC6CCC(C5)N6)nc(OC[C@@]56CCCN5CC(F)C6)nc4n3C)c12 |
| InChI | InChI=1S/C31H35F2N7O2/c1-17-24(33)7-4-18-10-22(41)11-23(25(17)18)27-35-26-28(38(27)2)36-30(37-29(26)39-14-20-5-6-21(15-39)34-20)42-16-31-8-3-9-40(31)13-19(32)12-31/h4,7,10-11,19-21,34,41H,3,5-6,8-9,12-16H2,1-2H3/t19?,20?,21?,31-/m0/s1 |
| InChIKey | GHMCEWGINCEURE-PVHWJRKLSA-N |
| XLogP | 4.23 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |