C17H37NO2 — CID 167242553
N-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]-2,2-dimethylbutan-1-amine (PubChem CID 167242553) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is N-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]-2,2-dimethylbutan-1-amine.
| Compound Name | N-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 167242553 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | N-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethyl]-2,2-dimethylbutan-1-amine |
| SMILES | CCC(C)(C)CNCCOCCOCCCC(C)(C)C |
| InChI | InChI=1S/C17H37NO2/c1-7-17(5,6)15-18-10-12-20-14-13-19-11-8-9-16(2,3)4/h18H,7-15H2,1-6H3 |
| InChIKey | COSLOUFKLPCWNF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|