C30H41N7O2 — CID 167242681
9-cyclopentyl-2-[[(1S)-1-[4-[3-methyl-1-(4-prop-2-enoylpiperazin-1-yl)butyl]phenyl]ethyl]amino]-7H-purin-8-one (PubChem CID 167242681) has the molecular formula C30H41N7O2 and a molecular weight of 531.71 g/mol. Its IUPAC name is 9-cyclopentyl-2-[[(1S)-1-[4-[3-methyl-1-(4-prop-2-enoylpiperazin-1-yl)butyl]phenyl]ethyl]amino]-7H-purin-8-one.
| Compound Name | 9-cyclopentyl-2-[[(1S)-1-[4-[3-methyl-1-(4-prop-2-enoylpiperazin-1-yl)butyl]phenyl]ethyl]amino]-7H-purin-8-one |
|---|---|
| PubChem CID | 167242681 |
| Molecular Formula | C30H41N7O2 |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | 9-cyclopentyl-2-[[(1S)-1-[4-[3-methyl-1-(4-prop-2-enoylpiperazin-1-yl)butyl]phenyl]ethyl]amino]-7H-purin-8-one |
| SMILES | C=CC(=O)N1CCN(C(CC(C)C)c2ccc([C@H](C)Nc3ncc4[nH]c(=O)n(C5CCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C30H41N7O2/c1-5-27(38)36-16-14-35(15-17-36)26(18-20(2)3)23-12-10-22(11-13-23)21(4)32-29-31-19-25-28(34-29)37(30(39)33-25)24-8-6-7-9-24/h5,10-13,19-21,24,26H,1,6-9,14-18H2,2-4H3,(H,33,39)(H,31,32,34)/t21-,26?/m0/s1 |
| InChIKey | SFSKWNHUQQNMPC-GVNKFJBHSA-N |
| XLogP | 4.83 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|