C25H36N4O5 — CID 16724386
ethyl (E,4S)-7-amino-4-[[(2S)-4-methyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoyl]amino]-7-oxohept-2-enoate (PubChem CID 16724386) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2S)-4-methyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-[[(2S)-4-methyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 16724386 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2S)-4-methyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]pentanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C25H36N4O5/c1-4-34-23(31)12-10-19(9-11-22(26)30)28-25(33)21(13-16(2)3)29-24(32)20-14-17-7-5-6-8-18(17)15-27-20/h5-8,10,12,16,19-21,27H,4,9,11,13-15H2,1-3H3,(H2,26,30)(H,28,33)(H,29,32)/b12-10+/t19-,20-,21-/m0/s1 |
| InChIKey | KDZFWMKTTHPDPH-XILNNULGSA-N |
| XLogP | 1.10 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|