C33H43N3O6S — CID 6478626
ethyl (E,4S)-7-amino-4-[[(2R,5S)-2-benzyl-5-(benzylsulfanylcarbonylamino)-7-methyl-4-oxooctanoyl]amino]-7-oxohept-2-enoate (PubChem CID 6478626) has the molecular formula C33H43N3O6S and a molecular weight of 609.79 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2R,5S)-2-benzyl-5-(benzylsulfanylcarbonylamino)-7-methyl-4-oxooctanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-[[(2R,5S)-2-benzyl-5-(benzylsulfanylcarbonylamino)-7-methyl-4-oxooctanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 6478626 |
| Molecular Formula | C33H43N3O6S |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2R,5S)-2-benzyl-5-(benzylsulfanylcarbonylamino)-7-methyl-4-oxooctanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)[C@@H](CC(=O)[C@H](CC(C)C)NC(=O)SCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H43N3O6S/c1-4-42-31(39)18-16-27(15-17-30(34)38)35-32(40)26(20-24-11-7-5-8-12-24)21-29(37)28(19-23(2)3)36-33(41)43-22-25-13-9-6-10-14-25/h5-14,16,18,23,26-28H,4,15,17,19-22H2,1-3H3,(H2,34,38)(H,35,40)(H,36,41)/b18-16+/t26-,27+,28+/m1/s1 |
| InChIKey | GFCDJOSRIBJPPT-AKBJHRGISA-N |
| XLogP | 4.73 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|