C31H46N4O6S — CID 73198079
ethyl 7-amino-4-[[2-[[2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]-methylamino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate (PubChem CID 73198079) has the molecular formula C31H46N4O6S and a molecular weight of 602.80 g/mol. Its IUPAC name is ethyl 7-amino-4-[[2-[[2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]-methylamino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl 7-amino-4-[[2-[[2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]-methylamino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 73198079 |
| Molecular Formula | C31H46N4O6S |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | ethyl 7-amino-4-[[2-[[2-(cyclopentylsulfanylcarbonylamino)-4-methylpentanoyl]-methylamino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)C=CC(CCC(N)=O)NC(=O)C(Cc1ccccc1)N(C)C(=O)C(CC(C)C)NC(=O)SC1CCCC1 |
| InChI | InChI=1S/C31H46N4O6S/c1-5-41-28(37)18-16-23(15-17-27(32)36)33-29(38)26(20-22-11-7-6-8-12-22)35(4)30(39)25(19-21(2)3)34-31(40)42-24-13-9-10-14-24/h6-8,11-12,16,18,21,23-26H,5,9-10,13-15,17,19-20H2,1-4H3,(H2,32,36)(H,33,38)(H,34,40) |
| InChIKey | RVPGLXQEGHIPIN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|