C14H15N3OS2 — CID 16724397
13-propyl-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one (PubChem CID 16724397) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 13-propyl-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one.
| Compound Name | 13-propyl-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
|---|---|
| PubChem CID | 16724397 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 13-propyl-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
| SMILES | CCCc1nn2c(=O)c3c4c(sc3nc2s1)CCCC4 |
| InChI | InChI=1S/C14H15N3OS2/c1-2-5-10-16-17-13(18)11-8-6-3-4-7-9(8)19-12(11)15-14(17)20-10/h2-7H2,1H3 |
| InChIKey | JGOUTQCXCCQEDO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |