C17H11Cl2N3OS2 — CID 16724509
13-(3,5-dichlorophenyl)-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one (PubChem CID 16724509) has the molecular formula C17H11Cl2N3OS2 and a molecular weight of 408.34 g/mol. Its IUPAC name is 13-(3,5-dichlorophenyl)-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one.
| Compound Name | 13-(3,5-dichlorophenyl)-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
|---|---|
| PubChem CID | 16724509 |
| Molecular Formula | C17H11Cl2N3OS2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 13-(3,5-dichlorophenyl)-8,12-dithia-10,14,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
| SMILES | O=c1c2c3c(sc2nc2sc(-c4cc(Cl)cc(Cl)c4)nn12)CCCC3 |
| InChI | InChI=1S/C17H11Cl2N3OS2/c18-9-5-8(6-10(19)7-9)14-21-22-16(23)13-11-3-1-2-4-12(11)24-15(13)20-17(22)25-14/h5-7H,1-4H2 |
| InChIKey | ZAIXYAHSYSYWSJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |