C18H18Cl2N4O4 — CID 167244126
4,6-dichloro-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]-1H-indole-2-carboxamide (PubChem CID 167244126) has the molecular formula C18H18Cl2N4O4 and a molecular weight of 425.27 g/mol. Its IUPAC name is 4,6-dichloro-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dichloro-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167244126 |
| Molecular Formula | C18H18Cl2N4O4 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4,6-dichloro-N-[2-oxo-2-[[1-oxo-3-(2-oxopyrrolidin-3-yl)propan-2-yl]amino]ethyl]-1H-indole-2-carboxamide |
| SMILES | O=CC(CC1CCNC1=O)NC(=O)CNC(=O)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C18H18Cl2N4O4/c19-10-4-13(20)12-6-15(24-14(12)5-10)18(28)22-7-16(26)23-11(8-25)3-9-1-2-21-17(9)27/h4-6,8-9,11,24H,1-3,7H2,(H,21,27)(H,22,28)(H,23,26) |
| InChIKey | OVKOJIBCMUHZCF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|