C20H23ClN4O5 — CID 156882320
N-[2-[[4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-2-oxoethyl]-4-methoxy-1H-indole-2-carboxamide (PubChem CID 156882320) has the molecular formula C20H23ClN4O5 and a molecular weight of 434.88 g/mol. Its IUPAC name is N-[2-[[4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-2-oxoethyl]-4-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[2-[[4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-2-oxoethyl]-4-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 156882320 |
| Molecular Formula | C20H23ClN4O5 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[2-[[4-chloro-3-oxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]amino]-2-oxoethyl]-4-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)NCC(=O)NC(CC3CCNC3=O)C(=O)CCl)cc12 |
| InChI | InChI=1S/C20H23ClN4O5/c1-30-17-4-2-3-13-12(17)8-15(24-13)20(29)23-10-18(27)25-14(16(26)9-21)7-11-5-6-22-19(11)28/h2-4,8,11,14,24H,5-7,9-10H2,1H3,(H,22,28)(H,23,29)(H,25,27) |
| InChIKey | ACSUOYFBPUGYJN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|