C28H30N4O7 — CID 164544451
[(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] benzoate (PubChem CID 164544451) has the molecular formula C28H30N4O7 and a molecular weight of 534.57 g/mol. Its IUPAC name is [(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] benzoate.
| Compound Name | [(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] benzoate |
|---|---|
| PubChem CID | 164544451 |
| Molecular Formula | C28H30N4O7 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] benzoate |
| SMILES | COc1cccc2[nH]c(C(=O)NCC(=O)N[C@@H](C[C@@H]3CCCNC3=O)C(=O)COC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C28H30N4O7/c1-38-24-11-5-10-20-19(24)14-22(31-20)27(36)30-15-25(34)32-21(13-18-9-6-12-29-26(18)35)23(33)16-39-28(37)17-7-3-2-4-8-17/h2-5,7-8,10-11,14,18,21,31H,6,9,12-13,15-16H2,1H3,(H,29,35)(H,30,36)(H,32,34)/t18-,21-/m0/s1 |
| InChIKey | UVPSBAFLDNCFQJ-RXVVDRJESA-N |
| XLogP | 1.73 |
| TPSA | 155.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |