C32H42N4O7 — CID 164544327
[(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] (2E)-2-ethenylpenta-2,4-dienoate;2-methylpropane (PubChem CID 164544327) has the molecular formula C32H42N4O7 and a molecular weight of 594.71 g/mol. Its IUPAC name is [(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] (2E)-2-ethenylpenta-2,4-dienoate;2-methylpropane.
| Compound Name | [(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] (2E)-2-ethenylpenta-2,4-dienoate;2-methylpropane |
|---|---|
| PubChem CID | 164544327 |
| Molecular Formula | C32H42N4O7 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | [(3S)-3-[[2-[(4-methoxy-1H-indole-2-carbonyl)amino]acetyl]amino]-2-oxo-4-[(3S)-2-oxopiperidin-3-yl]butyl] (2E)-2-ethenylpenta-2,4-dienoate;2-methylpropane |
| SMILES | C=C/C=C(\C=C)C(=O)OCC(=O)[C@H](C[C@@H]1CCCNC1=O)NC(=O)CNC(=O)c1cc2c(OC)cccc2[nH]1.CC(C)C |
| InChI | InChI=1S/C28H32N4O7.C4H10/c1-4-8-17(5-2)28(37)39-16-23(33)21(13-18-9-7-12-29-26(18)35)32-25(34)15-30-27(36)22-14-19-20(31-22)10-6-11-24(19)38-3;1-4(2)3/h4-6,8,10-11,14,18,21,31H,1-2,7,9,12-13,15-16H2,3H3,(H,29,35)(H,30,36)(H,32,34);4H,1-3H3/b17-8+;/t18-,21-;/m0./s1 |
| InChIKey | XLGZZDYLHOFZCB-GJWGHIRLSA-N |
| XLogP | 3.38 |
| TPSA | 155.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|