C24H26O6 — CID 16724616
ethyl (E,2Z)-4-methyl-3-oxo-5-phenyl-2-[(2,4,6-trimethoxyphenyl)methylidene]pent-4-enoate (PubChem CID 16724616) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl (E,2Z)-4-methyl-3-oxo-5-phenyl-2-[(2,4,6-trimethoxyphenyl)methylidene]pent-4-enoate.
| Compound Name | ethyl (E,2Z)-4-methyl-3-oxo-5-phenyl-2-[(2,4,6-trimethoxyphenyl)methylidene]pent-4-enoate |
|---|---|
| PubChem CID | 16724616 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | ethyl (E,2Z)-4-methyl-3-oxo-5-phenyl-2-[(2,4,6-trimethoxyphenyl)methylidene]pent-4-enoate |
| SMILES | CCOC(=O)/C(=C\c1c(OC)cc(OC)cc1OC)C(=O)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C24H26O6/c1-6-30-24(26)20(23(25)16(2)12-17-10-8-7-9-11-17)15-19-21(28-4)13-18(27-3)14-22(19)29-5/h7-15H,6H2,1-5H3/b16-12+,20-15- |
| InChIKey | UMSKVJRBRSITDP-PNGQTJDWSA-N |
| XLogP | 4.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|