C33H33N3O3 — CID 167249005
methyl 4-[[4-but-1-ynyl-1-[(4-phenylphenyl)methyl]indazole-7-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 167249005) has the molecular formula C33H33N3O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is methyl 4-[[4-but-1-ynyl-1-[(4-phenylphenyl)methyl]indazole-7-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[4-but-1-ynyl-1-[(4-phenylphenyl)methyl]indazole-7-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167249005 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | methyl 4-[[4-but-1-ynyl-1-[(4-phenylphenyl)methyl]indazole-7-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCC#Cc1ccc(C(=O)NC2CCC(C(=O)OC)CC2)c2c1cnn2Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H33N3O3/c1-3-4-8-26-17-20-29(32(37)35-28-18-15-27(16-19-28)33(38)39-2)31-30(26)21-34-36(31)22-23-11-13-25(14-12-23)24-9-6-5-7-10-24/h5-7,9-14,17,20-21,27-28H,3,15-16,18-19,22H2,1-2H3,(H,35,37) |
| InChIKey | YFDMDUZNWJWSLW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|