C14H24N2O6 — CID 167250780
2-[6,9-bis(carboxymethyl)-1,6-diazecan-3-yl]acetic acid (PubChem CID 167250780) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-[6,9-bis(carboxymethyl)-1,6-diazecan-3-yl]acetic acid.
| Compound Name | 2-[6,9-bis(carboxymethyl)-1,6-diazecan-3-yl]acetic acid |
|---|---|
| PubChem CID | 167250780 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-[6,9-bis(carboxymethyl)-1,6-diazecan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(CC(=O)O)CCC(CC(=O)O)CNC1 |
| InChI | InChI=1S/C14H24N2O6/c17-12(18)5-10-1-3-16(9-14(21)22)4-2-11(6-13(19)20)8-15-7-10/h10-11,15H,1-9H2,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | LNJQZYLAHICMEB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |