C12H25N2O3PS — CID 167251320
(2S)-2-[[(2R)-3-amino-2,3-dimethylbutanoyl]amino]-4-methyl-4-phosphanylsulfanylpentanoic acid (PubChem CID 167251320) has the molecular formula C12H25N2O3PS and a molecular weight of 308.38 g/mol. Its IUPAC name is (2S)-2-[[(2R)-3-amino-2,3-dimethylbutanoyl]amino]-4-methyl-4-phosphanylsulfanylpentanoic acid.
| Compound Name | (2S)-2-[[(2R)-3-amino-2,3-dimethylbutanoyl]amino]-4-methyl-4-phosphanylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 167251320 |
| Molecular Formula | C12H25N2O3PS |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (2S)-2-[[(2R)-3-amino-2,3-dimethylbutanoyl]amino]-4-methyl-4-phosphanylsulfanylpentanoic acid |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)(C)SP)C(=O)O)C(C)(C)N |
| InChI | InChI=1S/C12H25N2O3PS/c1-7(12(4,5)13)9(15)14-8(10(16)17)6-11(2,3)19-18/h7-8H,6,13,18H2,1-5H3,(H,14,15)(H,16,17)/t7-,8-/m0/s1 |
| InChIKey | RUZVEFAYUZHYFB-YUMQZZPRSA-N |
| XLogP | 1.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|