C52H36N4 — CID 167251927
5-[3-[2-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenylphenyl]-6,7-didehydro-8H-cyclohepta[b]indole (PubChem CID 167251927) has the molecular formula C52H36N4 and a molecular weight of 716.89 g/mol. Its IUPAC name is 5-[3-[2-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenylphenyl]-6,7-didehydro-8H-cyclohepta[b]indole.
| Compound Name | 5-[3-[2-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenylphenyl]-6,7-didehydro-8H-cyclohepta[b]indole |
|---|---|
| PubChem CID | 167251927 |
| Molecular Formula | C52H36N4 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | 5-[3-[2-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenylphenyl]-6,7-didehydro-8H-cyclohepta[b]indole |
| SMILES | C1#Cc2c(c3ccccc3n2-c2ccc(-c3ccccc3)c(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3C3=CCCC=C3)c2)C=CC1 |
| InChI | InChI=1S/C52H36N4/c1-6-18-36(19-7-1)42-33-31-41(56-48-28-15-5-14-26-44(48)45-27-16-17-29-49(45)56)35-47(42)43-32-30-40(34-46(43)37-20-8-2-9-21-37)52-54-50(38-22-10-3-11-23-38)53-51(55-52)39-24-12-4-13-25-39/h1,3-4,6-8,10-14,16-27,29-35H,2,5,9H2 |
| InChIKey | BCIVVZUAQOMXOS-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|