C18H16F6N4O — CID 16725327
(2R,3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine (PubChem CID 16725327) has the molecular formula C18H16F6N4O and a molecular weight of 418.34 g/mol. Its IUPAC name is (2R,3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 16725327 |
| Molecular Formula | C18H16F6N4O |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (2R,3S,5R)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cnc(C(F)(F)F)nc3C2)CO[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H16F6N4O/c19-11-3-13(21)12(20)2-10(11)16-14(25)1-9(7-29-16)28-5-8-4-26-17(18(22,23)24)27-15(8)6-28/h2-4,9,14,16H,1,5-7,25H2/t9-,14+,16-/m1/s1 |
| InChIKey | VSCBQPDWKUHXFU-WKFLNTIRSA-N |
| XLogP | 3.09 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|