C12H25F2NO3 — CID 167253727
2-[2-[4-(tert-butylamino)-2,2-difluorobutoxy]ethoxy]ethanol (PubChem CID 167253727) has the molecular formula C12H25F2NO3 and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-[2-[4-(tert-butylamino)-2,2-difluorobutoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[4-(tert-butylamino)-2,2-difluorobutoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 167253727 |
| Molecular Formula | C12H25F2NO3 |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-[2-[4-(tert-butylamino)-2,2-difluorobutoxy]ethoxy]ethanol |
| SMILES | CC(C)(C)NCCC(F)(F)COCCOCCO |
| InChI | InChI=1S/C12H25F2NO3/c1-11(2,3)15-5-4-12(13,14)10-18-9-8-17-7-6-16/h15-16H,4-10H2,1-3H3 |
| InChIKey | JJDRBFGRYHEMKL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|