C15H19F3O5S — CID 167254412
6-methoxy-7-[4-(trifluoromethyl)phenyl]sulfonylheptanoic acid (PubChem CID 167254412) has the molecular formula C15H19F3O5S and a molecular weight of 368.37 g/mol. Its IUPAC name is 6-methoxy-7-[4-(trifluoromethyl)phenyl]sulfonylheptanoic acid.
| Compound Name | 6-methoxy-7-[4-(trifluoromethyl)phenyl]sulfonylheptanoic acid |
|---|---|
| PubChem CID | 167254412 |
| Molecular Formula | C15H19F3O5S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 6-methoxy-7-[4-(trifluoromethyl)phenyl]sulfonylheptanoic acid |
| SMILES | COC(CCCCC(=O)O)CS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3O5S/c1-23-12(4-2-3-5-14(19)20)10-24(21,22)13-8-6-11(7-9-13)15(16,17)18/h6-9,12H,2-5,10H2,1H3,(H,19,20) |
| InChIKey | KPADCJIVSGRBQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|