C28H25ClFN5O2 — CID 167254462
5-chloro-1-[[5-(4-fluorophenyl)pyrazin-2-yl]methyl]-N-[6-(2-oxoethyl)spiro[3.3]heptan-2-yl]indazole-7-carboxamide (PubChem CID 167254462) has the molecular formula C28H25ClFN5O2 and a molecular weight of 517.99 g/mol. Its IUPAC name is 5-chloro-1-[[5-(4-fluorophenyl)pyrazin-2-yl]methyl]-N-[6-(2-oxoethyl)spiro[3.3]heptan-2-yl]indazole-7-carboxamide.
| Compound Name | 5-chloro-1-[[5-(4-fluorophenyl)pyrazin-2-yl]methyl]-N-[6-(2-oxoethyl)spiro[3.3]heptan-2-yl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 167254462 |
| Molecular Formula | C28H25ClFN5O2 |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 5-chloro-1-[[5-(4-fluorophenyl)pyrazin-2-yl]methyl]-N-[6-(2-oxoethyl)spiro[3.3]heptan-2-yl]indazole-7-carboxamide |
| SMILES | O=CCC1CC2(C1)CC(NC(=O)c1cc(Cl)cc3cnn(Cc4cnc(-c5ccc(F)cc5)cn4)c13)C2 |
| InChI | InChI=1S/C28H25ClFN5O2/c29-20-7-19-13-33-35(16-23-14-32-25(15-31-23)18-1-3-21(30)4-2-18)26(19)24(8-20)27(37)34-22-11-28(12-22)9-17(10-28)5-6-36/h1-4,6-8,13-15,17,22H,5,9-12,16H2,(H,34,37) |
| InChIKey | QJUQAZQJVXNTQU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|