C30H38N6O7 — CID 167258422
[(2R,3S,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 167258422) has the molecular formula C30H38N6O7 and a molecular weight of 594.67 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [(2R,3S,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 167258422 |
| Molecular Formula | C30H38N6O7 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | [(2R,3S,5R)-5-(4-amino-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-[(2-phenylacetyl)oxymethyl]oxolan-3-yl] (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)O[C@H]1C[C@](C#N)(C2CC=C3C(N)=NC=NN32)O[C@@H]1COC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C30H38N6O7/c1-18(2)25(35-28(39)43-29(3,4)5)27(38)41-21-14-30(16-31,23-12-11-20-26(32)33-17-34-36(20)23)42-22(21)15-40-24(37)13-19-9-7-6-8-10-19/h6-11,17-18,21-23,25H,12-15H2,1-5H3,(H,35,39)(H2,32,33,34)/t21-,22+,23?,25-,30-/m0/s1 |
| InChIKey | ZNGPCFDPCQRJII-WZWGAXQTSA-N |
| XLogP | 2.56 |
| TPSA | 177.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|