C14H14F2N2O4 — CID 167259616
2-(difluoromethyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxy-3H-quinazolin-4-one (PubChem CID 167259616) has the molecular formula C14H14F2N2O4 and a molecular weight of 312.27 g/mol. Its IUPAC name is 2-(difluoromethyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxy-3H-quinazolin-4-one.
| Compound Name | 2-(difluoromethyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 167259616 |
| Molecular Formula | C14H14F2N2O4 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(difluoromethyl)-7-methoxy-6-[(3S)-oxolan-3-yl]oxy-3H-quinazolin-4-one |
| SMILES | COc1cc2nc(C(F)F)[nH]c(=O)c2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C14H14F2N2O4/c1-20-10-5-9-8(14(19)18-13(17-9)12(15)16)4-11(10)22-7-2-3-21-6-7/h4-5,7,12H,2-3,6H2,1H3,(H,17,18,19)/t7-/m0/s1 |
| InChIKey | WFBGWYRDKXPCAG-ZETCQYMHSA-N |
| XLogP | 2.04 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |