C15H18N4OS — CID 16726195
5-methyl-6-methylimino-17-thia-2,5,8-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,11(16)-trien-9-one (PubChem CID 16726195) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 5-methyl-6-methylimino-17-thia-2,5,8-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,11(16)-trien-9-one.
| Compound Name | 5-methyl-6-methylimino-17-thia-2,5,8-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,11(16)-trien-9-one |
|---|---|
| PubChem CID | 16726195 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 5-methyl-6-methylimino-17-thia-2,5,8-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,11(16)-trien-9-one |
| SMILES | C/N=C1\Cn2c(nc3sc4c(c3c2=O)CCCC4)CN1C |
| InChI | InChI=1S/C15H18N4OS/c1-16-11-8-19-12(7-18(11)2)17-14-13(15(19)20)9-5-3-4-6-10(9)21-14/h3-8H2,1-2H3/b16-11+ |
| InChIKey | CDWNZOYUPVVMLQ-LFIBNONCSA-N |
| XLogP | 1.81 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|