C13H13IN2OS2 — CID 1108237
(13S)-13-(iodomethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one (PubChem CID 1108237) has the molecular formula C13H13IN2OS2 and a molecular weight of 404.30 g/mol. Its IUPAC name is (13S)-13-(iodomethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one.
| Compound Name | (13S)-13-(iodomethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one |
|---|---|
| PubChem CID | 1108237 |
| Molecular Formula | C13H13IN2OS2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | (13S)-13-(iodomethyl)-8,12-dithia-10,15-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-16-one |
| SMILES | O=c1c2c3c(sc2nc2n1C[C@@H](CI)S2)CCCC3 |
| InChI | InChI=1S/C13H13IN2OS2/c14-5-7-6-16-12(17)10-8-3-1-2-4-9(8)19-11(10)15-13(16)18-7/h7H,1-6H2/t7-/m1/s1 |
| InChIKey | MRKFVDKWXNAXNV-SSDOTTSWSA-N |
| XLogP | 3.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|