C13H13N2NaOS2 — CID 21238616
sodium 4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate (PubChem CID 21238616) has the molecular formula C13H13N2NaOS2 and a molecular weight of 300.38 g/mol. Its IUPAC name is sodium 4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate.
| Compound Name | sodium 4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate |
|---|---|
| PubChem CID | 21238616 |
| Molecular Formula | C13H13N2NaOS2 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | sodium 4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate |
| SMILES | C=CCn1c([S-])nc2sc3c(c2c1=O)CCCC3.[Na+] |
| InChI | InChI=1S/C13H14N2OS2.Na/c1-2-7-15-12(16)10-8-5-3-4-6-9(8)18-11(10)14-13(15)17;/h2H,1,3-7H2,(H,14,17);/q;+1/p-1 |
| InChIKey | SDQPELJPZNTSNR-UHFFFAOYSA-M |
| XLogP | -0.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|