C13H13N2OS2- — CID 5125052
4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate (PubChem CID 5125052) has the molecular formula C13H13N2OS2- and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate.
| Compound Name | 4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate |
|---|---|
| PubChem CID | 5125052 |
| Molecular Formula | C13H13N2OS2- |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate |
| SMILES | C=CCn1c([S-])nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C13H14N2OS2/c1-2-7-15-12(16)10-8-5-3-4-6-9(8)18-11(10)14-13(15)17/h2H,1,3-7H2,(H,14,17)/p-1 |
| InChIKey | ZDHGJHRONIXYAM-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|