C20H20N2O3S3 — CID 23968888
2-(4-methylphenyl)sulfonylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 23968888) has the molecular formula C20H20N2O3S3 and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-methylphenyl)sulfonylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 23968888 |
| Molecular Formula | C20H20N2O3S3 |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 2-(4-methylphenyl)sulfonylsulfanyl-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SS(=O)(=O)c2ccc(C)cc2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C20H20N2O3S3/c1-3-12-22-19(23)17-15-6-4-5-7-16(15)26-18(17)21-20(22)27-28(24,25)14-10-8-13(2)9-11-14/h3,8-11H,1,4-7,12H2,2H3 |
| InChIKey | VMVRLSFNMWOYSL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|