C23H26N2O3S2 — CID 3367513
2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3367513) has the molecular formula C23H26N2O3S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3367513 |
| Molecular Formula | C23H26N2O3S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCCOc2ccc(OCC)cc2)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C23H26N2O3S2/c1-3-13-25-22(26)20-18-7-5-6-8-19(18)30-21(20)24-23(25)29-15-14-28-17-11-9-16(10-12-17)27-4-2/h3,9-12H,1,4-8,13-15H2,2H3 |
| InChIKey | CLAVKZSBRJWDFG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|