C22H22Cl2N2O2S2 — CID 4986072
5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one (PubChem CID 4986072) has the molecular formula C22H22Cl2N2O2S2 and a molecular weight of 481.47 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 4986072 |
| Molecular Formula | C22H22Cl2N2O2S2 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-prop-2-enyl-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),5-trien-3-one |
| SMILES | C=CCn1c(SCCOc2ccc(Cl)cc2Cl)nc2sc3c(c2c1=O)CCCCC3 |
| InChI | InChI=1S/C22H22Cl2N2O2S2/c1-2-10-26-21(27)19-15-6-4-3-5-7-18(15)30-20(19)25-22(26)29-12-11-28-17-9-8-14(23)13-16(17)24/h2,8-9,13H,1,3-7,10-12H2 |
| InChIKey | JPIRUHRQMZJTLY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|