C17H23N3OS — CID 39148539
3-cyclopropyl-2-(propylaminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 39148539) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 3-cyclopropyl-2-(propylaminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-cyclopropyl-2-(propylaminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 39148539 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-cyclopropyl-2-(propylaminomethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCNCc1nc2sc3c(c2c(=O)n1C1CC1)CCCC3 |
| InChI | InChI=1S/C17H23N3OS/c1-2-9-18-10-14-19-16-15(17(21)20(14)11-7-8-11)12-5-3-4-6-13(12)22-16/h11,18H,2-10H2,1H3 |
| InChIKey | VQTWSTUSMSIIHV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|