C17H25N3O2S — CID 39148919
3-cyclopropyl-2-[(5-hydroxypentylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 39148919) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-cyclopropyl-2-[(5-hydroxypentylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-cyclopropyl-2-[(5-hydroxypentylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 39148919 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-cyclopropyl-2-[(5-hydroxypentylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CNCCCCCO)n(C3CC3)c(=O)c2c1C |
| InChI | InChI=1S/C17H25N3O2S/c1-11-12(2)23-16-15(11)17(22)20(13-6-7-13)14(19-16)10-18-8-4-3-5-9-21/h13,18,21H,3-10H2,1-2H3 |
| InChIKey | YFNMEKWNYVZBCB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|