C12H14I6N2OS2 — CID 21235675
11-(iodomethyl)-4,5,10-trimethyl-6-thia-10-thionia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one;bis(molecular iodine);iodide (PubChem CID 21235675) has the molecular formula C12H14I6N2OS2 and a molecular weight of 1027.81 g/mol. Its IUPAC name is 11-(iodomethyl)-4,5,10-trimethyl-6-thia-10-thionia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one;bis(molecular iodine);iodide.
| Compound Name | 11-(iodomethyl)-4,5,10-trimethyl-6-thia-10-thionia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one;bis(molecular iodine);iodide |
|---|---|
| PubChem CID | 21235675 |
| Molecular Formula | C12H14I6N2OS2 |
| Molecular Weight | 1027.81 g/mol |
| Exact Mass | 1027.48 |
| IUPAC Name | 11-(iodomethyl)-4,5,10-trimethyl-6-thia-10-thionia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one;bis(molecular iodine);iodide |
| SMILES | Cc1sc2nc3n(c(=O)c2c1C)CC(CI)[S+]3C.II.II.[I-] |
| InChI | InChI=1S/C12H14IN2OS2.2I2.HI/c1-6-7(2)17-10-9(6)11(16)15-5-8(4-13)18(3)12(15)14-10;2*1-2;/h8H,4-5H2,1-3H3;;;1H/q+1;;;/p-1 |
| InChIKey | IUGSREBGRMILRP-UHFFFAOYSA-M |
| XLogP | 3.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|