C14H19N3O2S — CID 39147039
3-cyclopropyl-2-[(2-hydroxyethylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 39147039) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-cyclopropyl-2-[(2-hydroxyethylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-cyclopropyl-2-[(2-hydroxyethylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 39147039 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-cyclopropyl-2-[(2-hydroxyethylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CNCCO)n(C3CC3)c(=O)c2c1C |
| InChI | InChI=1S/C14H19N3O2S/c1-8-9(2)20-13-12(8)14(19)17(10-3-4-10)11(16-13)7-15-5-6-18/h10,15,18H,3-7H2,1-2H3 |
| InChIKey | YPHRZVHBRYRFIM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|