C14H17NO3 — CID 16726196
methyl 3-(1-acetyl-2,3-dihydroindol-3-yl)propanoate (PubChem CID 16726196) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is methyl 3-(1-acetyl-2,3-dihydroindol-3-yl)propanoate.
| Compound Name | methyl 3-(1-acetyl-2,3-dihydroindol-3-yl)propanoate |
|---|---|
| PubChem CID | 16726196 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | methyl 3-(1-acetyl-2,3-dihydroindol-3-yl)propanoate |
| SMILES | COC(=O)CCC1CN(C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C14H17NO3/c1-10(16)15-9-11(7-8-14(17)18-2)12-5-3-4-6-13(12)15/h3-6,11H,7-9H2,1-2H3 |
| InChIKey | DNJONIDEFIZKAR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |