C12H12ClNO3 — CID 16726375
ethyl (2E)-2-(4-chloro-1H-2,1-benzoxazol-3-ylidene)propanoate (PubChem CID 16726375) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is ethyl (2E)-2-(4-chloro-1H-2,1-benzoxazol-3-ylidene)propanoate.
| Compound Name | ethyl (2E)-2-(4-chloro-1H-2,1-benzoxazol-3-ylidene)propanoate |
|---|---|
| PubChem CID | 16726375 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | ethyl (2E)-2-(4-chloro-1H-2,1-benzoxazol-3-ylidene)propanoate |
| SMILES | CCOC(=O)/C(C)=C1/ONc2cccc(Cl)c21 |
| InChI | InChI=1S/C12H12ClNO3/c1-3-16-12(15)7(2)11-10-8(13)5-4-6-9(10)14-17-11/h4-6,14H,3H2,1-2H3/b11-7+ |
| InChIKey | JBMDFKRBGJDHFP-YRNVUSSQSA-N |
| XLogP | 2.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|