C27H28FN5O3 — CID 167265410
6-N-(3-ethyl-4-methoxyphenyl)-4-N-[(2-fluoro-3-methyl-5-nitrophenyl)methyl]-6-N,2-dimethylquinazoline-4,6-diamine (PubChem CID 167265410) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is 6-N-(3-ethyl-4-methoxyphenyl)-4-N-[(2-fluoro-3-methyl-5-nitrophenyl)methyl]-6-N,2-dimethylquinazoline-4,6-diamine.
| Compound Name | 6-N-(3-ethyl-4-methoxyphenyl)-4-N-[(2-fluoro-3-methyl-5-nitrophenyl)methyl]-6-N,2-dimethylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 167265410 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 6-N-(3-ethyl-4-methoxyphenyl)-4-N-[(2-fluoro-3-methyl-5-nitrophenyl)methyl]-6-N,2-dimethylquinazoline-4,6-diamine |
| SMILES | CCc1cc(N(C)c2ccc3nc(C)nc(NCc4cc([N+](=O)[O-])cc(C)c4F)c3c2)ccc1OC |
| InChI | InChI=1S/C27H28FN5O3/c1-6-18-12-20(8-10-25(18)36-5)32(4)21-7-9-24-23(14-21)27(31-17(3)30-24)29-15-19-13-22(33(34)35)11-16(2)26(19)28/h7-14H,6,15H2,1-5H3,(H,29,30,31) |
| InChIKey | PKONVTREGQETRR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|