C18H28N12O9 — CID 167267018
(2S,3S,4R,6R)-5-azido-2-(azidomethyl)-6-[(2R,3S,4R,5R)-5-[(1S,2S)-3,5-diazido-2-hydroxycyclohexyl]oxy-4-hydroxy-2-(2-hydroxyethyl)oxolan-3-yl]oxyoxane-3,4-diol (PubChem CID 167267018) has the molecular formula C18H28N12O9 and a molecular weight of 556.50 g/mol. Its IUPAC name is (2S,3S,4R,6R)-5-azido-2-(azidomethyl)-6-[(2R,3S,4R,5R)-5-[(1S,2S)-3,5-diazido-2-hydroxycyclohexyl]oxy-4-hydroxy-2-(2-hydroxyethyl)oxolan-3-yl]oxyoxane-3,4-diol.
| Compound Name | (2S,3S,4R,6R)-5-azido-2-(azidomethyl)-6-[(2R,3S,4R,5R)-5-[(1S,2S)-3,5-diazido-2-hydroxycyclohexyl]oxy-4-hydroxy-2-(2-hydroxyethyl)oxolan-3-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 167267018 |
| Molecular Formula | C18H28N12O9 |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (2S,3S,4R,6R)-5-azido-2-(azidomethyl)-6-[(2R,3S,4R,5R)-5-[(1S,2S)-3,5-diazido-2-hydroxycyclohexyl]oxy-4-hydroxy-2-(2-hydroxyethyl)oxolan-3-yl]oxyoxane-3,4-diol |
| SMILES | [N-]=[N+]=NC[C@@H]1O[C@H](O[C@H]2[C@@H](O)[C@H](O[C@H]3CC(N=[N+]=[N-])CC(N=[N+]=[N-])[C@@H]3O)O[C@@H]2CCO)C(N=[N+]=[N-])[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H28N12O9/c19-27-23-5-10-13(33)14(34)11(26-30-22)17(38-10)39-16-8(1-2-31)36-18(15(16)35)37-9-4-6(24-28-20)3-7(12(9)32)25-29-21/h6-18,31-35H,1-5H2/t6?,7?,8-,9+,10+,11?,12+,13-,14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | IADFHEGOWKBFHA-ARLGUFSYSA-N |
| XLogP | 0.17 |
| TPSA | 333.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|