C16H28N14O5 — CID 90478132
(3S,4S,6R)-6-[(1S,2R,4R)-2-(4-aminobutylamino)-4,6-diazido-3-hydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxane-3,4-diol (PubChem CID 90478132) has the molecular formula C16H28N14O5 and a molecular weight of 496.49 g/mol. Its IUPAC name is (3S,4S,6R)-6-[(1S,2R,4R)-2-(4-aminobutylamino)-4,6-diazido-3-hydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxane-3,4-diol.
| Compound Name | (3S,4S,6R)-6-[(1S,2R,4R)-2-(4-aminobutylamino)-4,6-diazido-3-hydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 90478132 |
| Molecular Formula | C16H28N14O5 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (3S,4S,6R)-6-[(1S,2R,4R)-2-(4-aminobutylamino)-4,6-diazido-3-hydroxycyclohexyl]oxy-5-azido-2-(azidomethyl)oxane-3,4-diol |
| SMILES | [N-]=[N+]=NCC1O[C@@H](O[C@@H]2C(N=[N+]=[N-])C[C@@H](N=[N+]=[N-])C(O)[C@H]2NCCCCN)C(N=[N+]=[N-])[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H28N14O5/c17-3-1-2-4-22-10-12(31)7(24-28-19)5-8(25-29-20)15(10)35-16-11(26-30-21)14(33)13(32)9(34-16)6-23-27-18/h7-16,22,31-33H,1-6,17H2/t7-,8?,9?,10-,11?,12?,13-,14+,15-,16+/m1/s1 |
| InChIKey | LOUNHLKOVGZSPC-PFJJKFTPSA-N |
| XLogP | 0.63 |
| TPSA | 312.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|