C25H21F6N5O — CID 167271578
(3R,4R)-1-(3H-benzimidazol-5-yl)-3-cyclopropyl-4-[4-[(E)-1-[(methylideneamino)-(trifluoromethyl)amino]prop-1-en-2-yl]-2-(trifluoromethyl)phenyl]azetidin-2-one (PubChem CID 167271578) has the molecular formula C25H21F6N5O and a molecular weight of 521.47 g/mol. Its IUPAC name is (3R,4R)-1-(3H-benzimidazol-5-yl)-3-cyclopropyl-4-[4-[(E)-1-[(methylideneamino)-(trifluoromethyl)amino]prop-1-en-2-yl]-2-(trifluoromethyl)phenyl]azetidin-2-one.
| Compound Name | (3R,4R)-1-(3H-benzimidazol-5-yl)-3-cyclopropyl-4-[4-[(E)-1-[(methylideneamino)-(trifluoromethyl)amino]prop-1-en-2-yl]-2-(trifluoromethyl)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 167271578 |
| Molecular Formula | C25H21F6N5O |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (3R,4R)-1-(3H-benzimidazol-5-yl)-3-cyclopropyl-4-[4-[(E)-1-[(methylideneamino)-(trifluoromethyl)amino]prop-1-en-2-yl]-2-(trifluoromethyl)phenyl]azetidin-2-one |
| SMILES | C=NN(/C=C(\C)c1ccc([C@H]2[C@@H](C3CC3)C(=O)N2c2ccc3nc[nH]c3c2)c(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H21F6N5O/c1-13(11-35(32-2)25(29,30)31)15-5-7-17(18(9-15)24(26,27)28)22-21(14-3-4-14)23(37)36(22)16-6-8-19-20(10-16)34-12-33-19/h5-12,14,21-22H,2-4H2,1H3,(H,33,34)/b13-11+/t21-,22+/m1/s1 |
| InChIKey | SPYXGGZYCJVTJF-CTPSXVSOSA-N |
| XLogP | 6.49 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|