C23H26IN3O3 — CID 167272423
2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3-hydroxycyclobutyl)oxy-2-pyridinyl]-4-iodobenzamide (PubChem CID 167272423) has the molecular formula C23H26IN3O3 and a molecular weight of 519.38 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3-hydroxycyclobutyl)oxy-2-pyridinyl]-4-iodobenzamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3-hydroxycyclobutyl)oxy-2-pyridinyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 167272423 |
| Molecular Formula | C23H26IN3O3 |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-N-[6-(3-hydroxycyclobutyl)oxy-2-pyridinyl]-4-iodobenzamide |
| SMILES | O=C(Nc1cccc(OC2CC(O)C2)n1)c1ccc(I)cc1N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C23H26IN3O3/c24-15-4-5-18(19(12-15)27-10-8-23(6-7-23)9-11-27)22(29)26-20-2-1-3-21(25-20)30-17-13-16(28)14-17/h1-5,12,16-17,28H,6-11,13-14H2,(H,25,26,29) |
| InChIKey | BIXHUYKGVZNQGN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|